C24H30N4O2 — CID 134186574
5-[2-ethyl-5-[ethyl-(2-methylquinazolin-4-yl)amino]phenyl]-N-hydroxypentanamide (PubChem CID 134186574) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 5-[2-ethyl-5-[ethyl-(2-methylquinazolin-4-yl)amino]phenyl]-N-hydroxypentanamide.
| Compound Name | 5-[2-ethyl-5-[ethyl-(2-methylquinazolin-4-yl)amino]phenyl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 134186574 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 5-[2-ethyl-5-[ethyl-(2-methylquinazolin-4-yl)amino]phenyl]-N-hydroxypentanamide |
| SMILES | CCc1ccc(N(CC)c2nc(C)nc3ccccc23)cc1CCCCC(=O)NO |
| InChI | InChI=1S/C24H30N4O2/c1-4-18-14-15-20(16-19(18)10-6-9-13-23(29)27-30)28(5-2)24-21-11-7-8-12-22(21)25-17(3)26-24/h7-8,11-12,14-16,30H,4-6,9-10,13H2,1-3H3,(H,27,29) |
| InChIKey | CGFNMZQLBBZFQW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|