C29H40N4 — CID 134186481
N-[4-ethyl-3-[5-(methylamino)hex-5-enyl]phenyl]-2-methyl-N-pentylquinazolin-4-amine (PubChem CID 134186481) has the molecular formula C29H40N4 and a molecular weight of 444.67 g/mol. Its IUPAC name is N-[4-ethyl-3-[5-(methylamino)hex-5-enyl]phenyl]-2-methyl-N-pentylquinazolin-4-amine.
| Compound Name | N-[4-ethyl-3-[5-(methylamino)hex-5-enyl]phenyl]-2-methyl-N-pentylquinazolin-4-amine |
|---|---|
| PubChem CID | 134186481 |
| Molecular Formula | C29H40N4 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | N-[4-ethyl-3-[5-(methylamino)hex-5-enyl]phenyl]-2-methyl-N-pentylquinazolin-4-amine |
| SMILES | C=C(CCCCc1cc(N(CCCCC)c2nc(C)nc3ccccc23)ccc1CC)NC |
| InChI | InChI=1S/C29H40N4/c1-6-8-13-20-33(29-27-16-11-12-17-28(27)31-23(4)32-29)26-19-18-24(7-2)25(21-26)15-10-9-14-22(3)30-5/h11-12,16-19,21,30H,3,6-10,13-15,20H2,1-2,4-5H3 |
| InChIKey | OZICUWWPUPUDGS-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|