C27H35N3O4 — CID 134186608
ethyl 5-[2-ethyl-5-[methoxymethoxymethyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanoate (PubChem CID 134186608) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is ethyl 5-[2-ethyl-5-[methoxymethoxymethyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanoate.
| Compound Name | ethyl 5-[2-ethyl-5-[methoxymethoxymethyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanoate |
|---|---|
| PubChem CID | 134186608 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | ethyl 5-[2-ethyl-5-[methoxymethoxymethyl-(2-methylquinazolin-4-yl)amino]phenyl]pentanoate |
| SMILES | CCOC(=O)CCCCc1cc(N(COCOC)c2nc(C)nc3ccccc23)ccc1CC |
| InChI | InChI=1S/C27H35N3O4/c1-5-21-15-16-23(17-22(21)11-7-10-14-26(31)34-6-2)30(18-33-19-32-4)27-24-12-8-9-13-25(24)28-20(3)29-27/h8-9,12-13,15-17H,5-7,10-11,14,18-19H2,1-4H3 |
| InChIKey | VVAQJNOIJOYBTH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|