C22H21F3N2O2 — CID 166735027
ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]quinazolin-6-yl]butanoate (PubChem CID 166735027) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]quinazolin-6-yl]butanoate.
| Compound Name | ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]quinazolin-6-yl]butanoate |
|---|---|
| PubChem CID | 166735027 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 3-[2-methyl-4-[3-(trifluoromethyl)phenyl]quinazolin-6-yl]butanoate |
| SMILES | CCOC(=O)CC(C)c1ccc2nc(C)nc(-c3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C22H21F3N2O2/c1-4-29-20(28)10-13(2)15-8-9-19-18(12-15)21(27-14(3)26-19)16-6-5-7-17(11-16)22(23,24)25/h5-9,11-13H,4,10H2,1-3H3 |
| InChIKey | MHQWUUOOTPRHBL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |