C28H24F4N2O2 — CID 70327593
ethyl 4-[[6-fluoro-2-[4-[3-(trifluoromethyl)phenyl]phenyl]quinolin-4-yl]amino]butanoate (PubChem CID 70327593) has the molecular formula C28H24F4N2O2 and a molecular weight of 496.50 g/mol. Its IUPAC name is ethyl 4-[[6-fluoro-2-[4-[3-(trifluoromethyl)phenyl]phenyl]quinolin-4-yl]amino]butanoate.
| Compound Name | ethyl 4-[[6-fluoro-2-[4-[3-(trifluoromethyl)phenyl]phenyl]quinolin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 70327593 |
| Molecular Formula | C28H24F4N2O2 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | ethyl 4-[[6-fluoro-2-[4-[3-(trifluoromethyl)phenyl]phenyl]quinolin-4-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1cc(-c2ccc(-c3cccc(C(F)(F)F)c3)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C28H24F4N2O2/c1-2-36-27(35)7-4-14-33-26-17-25(34-24-13-12-22(29)16-23(24)26)19-10-8-18(9-11-19)20-5-3-6-21(15-20)28(30,31)32/h3,5-6,8-13,15-17H,2,4,7,14H2,1H3,(H,33,34) |
| InChIKey | XDBZRCZEOKMEBA-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|