C27H21F3N2O4 — CID 46298787
ethyl 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]-2-phenylquinoline-6-carboxylate (PubChem CID 46298787) has the molecular formula C27H21F3N2O4 and a molecular weight of 494.47 g/mol. Its IUPAC name is ethyl 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]-2-phenylquinoline-6-carboxylate.
| Compound Name | ethyl 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]-2-phenylquinoline-6-carboxylate |
|---|---|
| PubChem CID | 46298787 |
| Molecular Formula | C27H21F3N2O4 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | ethyl 4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]-2-phenylquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(-c3ccccc3)cc(OCC(=O)Nc3cccc(C(F)(F)F)c3)c2c1 |
| InChI | InChI=1S/C27H21F3N2O4/c1-2-35-26(34)18-11-12-22-21(13-18)24(15-23(32-22)17-7-4-3-5-8-17)36-16-25(33)31-20-10-6-9-19(14-20)27(28,29)30/h3-15H,2,16H2,1H3,(H,31,33) |
| InChIKey | QYEPJMLGRJWBLR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |