C28H23FN2O5 — CID 46298879
ethyl 4-[2-(4-acetylanilino)-2-oxoethoxy]-2-(4-fluorophenyl)quinoline-6-carboxylate (PubChem CID 46298879) has the molecular formula C28H23FN2O5 and a molecular weight of 486.50 g/mol. Its IUPAC name is ethyl 4-[2-(4-acetylanilino)-2-oxoethoxy]-2-(4-fluorophenyl)quinoline-6-carboxylate.
| Compound Name | ethyl 4-[2-(4-acetylanilino)-2-oxoethoxy]-2-(4-fluorophenyl)quinoline-6-carboxylate |
|---|---|
| PubChem CID | 46298879 |
| Molecular Formula | C28H23FN2O5 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | ethyl 4-[2-(4-acetylanilino)-2-oxoethoxy]-2-(4-fluorophenyl)quinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(-c3ccc(F)cc3)cc(OCC(=O)Nc3ccc(C(C)=O)cc3)c2c1 |
| InChI | InChI=1S/C28H23FN2O5/c1-3-35-28(34)20-8-13-24-23(14-20)26(15-25(31-24)19-4-9-21(29)10-5-19)36-16-27(33)30-22-11-6-18(7-12-22)17(2)32/h4-15H,3,16H2,1-2H3,(H,30,33) |
| InChIKey | HQXZRXPXROSVHW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |