C27H23ClN2O4 — CID 46298757
ethyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-2-phenylquinoline-6-carboxylate (PubChem CID 46298757) has the molecular formula C27H23ClN2O4 and a molecular weight of 474.94 g/mol. Its IUPAC name is ethyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-2-phenylquinoline-6-carboxylate.
| Compound Name | ethyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-2-phenylquinoline-6-carboxylate |
|---|---|
| PubChem CID | 46298757 |
| Molecular Formula | C27H23ClN2O4 |
| Molecular Weight | 474.94 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | ethyl 4-[2-(3-chloro-4-methylanilino)-2-oxoethoxy]-2-phenylquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(-c3ccccc3)cc(OCC(=O)Nc3ccc(C)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C27H23ClN2O4/c1-3-33-27(32)19-10-12-23-21(13-19)25(15-24(30-23)18-7-5-4-6-8-18)34-16-26(31)29-20-11-9-17(2)22(28)14-20/h4-15H,3,16H2,1-2H3,(H,29,31) |
| InChIKey | BMZJIKBLGNZQNZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.94 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |