C18H19F6N5O3 — CID 58039597
ethyl 4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]butanoate (PubChem CID 58039597) has the molecular formula C18H19F6N5O3 and a molecular weight of 467.37 g/mol. Its IUPAC name is ethyl 4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]butanoate.
| Compound Name | ethyl 4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 58039597 |
| Molecular Formula | C18H19F6N5O3 |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | ethyl 4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNc1nc(Nc2cccc(C(F)(F)F)c2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C18H19F6N5O3/c1-2-31-13(30)7-4-8-25-14-27-15(29-16(28-14)32-10-17(19,20)21)26-12-6-3-5-11(9-12)18(22,23)24/h3,5-6,9H,2,4,7-8,10H2,1H3,(H2,25,26,27,28,29) |
| InChIKey | KTOVAYRGZAYVKG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|