C21H20F6N6O3S — CID 58039646
N,N-dimethyl-4-[[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide (PubChem CID 58039646) has the molecular formula C21H20F6N6O3S and a molecular weight of 550.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58039646 |
| Molecular Formula | C21H20F6N6O3S |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | N,N-dimethyl-4-[[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNc2nc(Nc3cccc(C(F)(F)F)c3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C21H20F6N6O3S/c1-33(2)37(34,35)16-8-6-13(7-9-16)11-28-17-30-18(32-19(31-17)36-12-20(22,23)24)29-15-5-3-4-14(10-15)21(25,26)27/h3-10H,11-12H2,1-2H3,(H2,28,29,30,31,32) |
| InChIKey | RGSSRWSPMFSKOC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |