C24H24F6N6O3S — CID 143835283
2-N-[1-(benzenesulfonyl)piperidin-4-yl]-2-N-methyl-6-(2,2,2-trifluoroethoxy)-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 143835283) has the molecular formula C24H24F6N6O3S and a molecular weight of 590.55 g/mol. Its IUPAC name is 2-N-[1-(benzenesulfonyl)piperidin-4-yl]-2-N-methyl-6-(2,2,2-trifluoroethoxy)-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[1-(benzenesulfonyl)piperidin-4-yl]-2-N-methyl-6-(2,2,2-trifluoroethoxy)-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 143835283 |
| Molecular Formula | C24H24F6N6O3S |
| Molecular Weight | 590.55 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 2-N-[1-(benzenesulfonyl)piperidin-4-yl]-2-N-methyl-6-(2,2,2-trifluoroethoxy)-4-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN(c1nc(Nc2cccc(C(F)(F)F)c2)nc(OCC(F)(F)F)n1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H24F6N6O3S/c1-35(18-10-12-36(13-11-18)40(37,38)19-8-3-2-4-9-19)21-32-20(33-22(34-21)39-15-23(25,26)27)31-17-7-5-6-16(14-17)24(28,29)30/h2-9,14,18H,10-13,15H2,1H3,(H,31,32,33,34) |
| InChIKey | MUZJYAHUNFNCRQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |