C22H22F6N8O3 — CID 87237308
3-methyl-6-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]-1H-pyrimidine-2,4-dione (PubChem CID 87237308) has the molecular formula C22H22F6N8O3 and a molecular weight of 560.46 g/mol. Its IUPAC name is 3-methyl-6-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-methyl-6-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87237308 |
| Molecular Formula | C22H22F6N8O3 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 3-methyl-6-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)cc(N2CCC(Nc3nc(Nc4cccc(C(F)(F)F)c4)nc(OCC(F)(F)F)n3)CC2)[nH]c1=O |
| InChI | InChI=1S/C22H22F6N8O3/c1-35-16(37)10-15(31-20(35)38)36-7-5-13(6-8-36)29-17-32-18(34-19(33-17)39-11-21(23,24)25)30-14-4-2-3-12(9-14)22(26,27)28/h2-4,9-10,13H,5-8,11H2,1H3,(H,31,38)(H2,29,30,32,33,34) |
| InChIKey | XGEUQEQMKHONHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |