C19H20F3N7O5S — CID 58039796
5-[[4-[(1-methylsulfonylpiperidin-4-yl)amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione (PubChem CID 58039796) has the molecular formula C19H20F3N7O5S and a molecular weight of 515.47 g/mol. Its IUPAC name is 5-[[4-[(1-methylsulfonylpiperidin-4-yl)amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione.
| Compound Name | 5-[[4-[(1-methylsulfonylpiperidin-4-yl)amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58039796 |
| Molecular Formula | C19H20F3N7O5S |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 5-[[4-[(1-methylsulfonylpiperidin-4-yl)amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]isoindole-1,3-dione |
| SMILES | CS(=O)(=O)N1CCC(Nc2nc(Nc3ccc4c(c3)C(=O)NC4=O)nc(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C19H20F3N7O5S/c1-35(32,33)29-6-4-10(5-7-29)23-16-26-17(28-18(27-16)34-9-19(20,21)22)24-11-2-3-12-13(8-11)15(31)25-14(12)30/h2-3,8,10H,4-7,9H2,1H3,(H,25,30,31)(H2,23,24,26,27,28) |
| InChIKey | RXGDQSAHQVCYSN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|