C21H25ClF4N6O3S — CID 58040458
4-N-(3-chloro-4-fluorophenyl)-2-N-(1-cyclopentylsulfonylpiperidin-4-yl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 58040458) has the molecular formula C21H25ClF4N6O3S and a molecular weight of 552.98 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-2-N-(1-cyclopentylsulfonylpiperidin-4-yl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-2-N-(1-cyclopentylsulfonylpiperidin-4-yl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58040458 |
| Molecular Formula | C21H25ClF4N6O3S |
| Molecular Weight | 552.98 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-2-N-(1-cyclopentylsulfonylpiperidin-4-yl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | O=S(=O)(C1CCCC1)N1CCC(Nc2nc(Nc3ccc(F)c(Cl)c3)nc(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C21H25ClF4N6O3S/c22-16-11-14(5-6-17(16)23)28-19-29-18(30-20(31-19)35-12-21(24,25)26)27-13-7-9-32(10-8-13)36(33,34)15-3-1-2-4-15/h5-6,11,13,15H,1-4,7-10,12H2,(H2,27,28,29,30,31) |
| InChIKey | FQUAMXYTIGBXMY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |