C17H28F3N7O3S — CID 58040225
2-N-(1-methylsulfonylpiperidin-4-yl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 58040225) has the molecular formula C17H28F3N7O3S and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-N-(1-methylsulfonylpiperidin-4-yl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(1-methylsulfonylpiperidin-4-yl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58040225 |
| Molecular Formula | C17H28F3N7O3S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-N-(1-methylsulfonylpiperidin-4-yl)-4-N-(2-pyrrolidin-1-ylethyl)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CS(=O)(=O)N1CCC(Nc2nc(NCCN3CCCC3)nc(OCC(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C17H28F3N7O3S/c1-31(28,29)27-9-4-13(5-10-27)22-15-23-14(21-6-11-26-7-2-3-8-26)24-16(25-15)30-12-17(18,19)20/h13H,2-12H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | FVQOBUMDXONMBT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |