C25H37N7 — CID 134088618
4-N-cyclohexyl-2-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 134088618) has the molecular formula C25H37N7 and a molecular weight of 435.62 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-cyclohexyl-2-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 134088618 |
| Molecular Formula | C25H37N7 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 4-N-cyclohexyl-2-N-(2,3-dihydro-1H-inden-2-yl)-6-N-(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc2c(c1)CC(Nc1nc(NCCN3CCCCC3)nc(NC3CCCCC3)n1)C2 |
| InChI | InChI=1S/C25H37N7/c1-3-11-21(12-4-1)27-24-29-23(26-13-16-32-14-7-2-8-15-32)30-25(31-24)28-22-17-19-9-5-6-10-20(19)18-22/h5-6,9-10,21-22H,1-4,7-8,11-18H2,(H3,26,27,28,29,30,31) |
| InChIKey | UMEXMJNSUKKHLL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |