C26H27F6N7O2 — CID 58039963
1-(4-methyl-2-pyridinyl)-3-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]propan-2-one (PubChem CID 58039963) has the molecular formula C26H27F6N7O2 and a molecular weight of 583.54 g/mol. Its IUPAC name is 1-(4-methyl-2-pyridinyl)-3-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]propan-2-one.
| Compound Name | 1-(4-methyl-2-pyridinyl)-3-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 58039963 |
| Molecular Formula | C26H27F6N7O2 |
| Molecular Weight | 583.54 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | 1-(4-methyl-2-pyridinyl)-3-[4-[[4-(2,2,2-trifluoroethoxy)-6-[3-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]amino]piperidin-1-yl]propan-2-one |
| SMILES | Cc1ccnc(CC(=O)CN2CCC(Nc3nc(Nc4cccc(C(F)(F)F)c4)nc(OCC(F)(F)F)n3)CC2)c1 |
| InChI | InChI=1S/C26H27F6N7O2/c1-16-5-8-33-20(11-16)13-21(40)14-39-9-6-18(7-10-39)34-22-36-23(38-24(37-22)41-15-25(27,28)29)35-19-4-2-3-17(12-19)26(30,31)32/h2-5,8,11-12,18H,6-7,9-10,13-15H2,1H3,(H2,34,35,36,37,38) |
| InChIKey | NVWSAIQIINYLSX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |