C25H27F6N7O — CID 58040193
4-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 58040193) has the molecular formula C25H27F6N7O and a molecular weight of 555.53 g/mol. Its IUPAC name is 4-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58040193 |
| Molecular Formula | C25H27F6N7O |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 4-[4-[[4-(dimethylamino)phenyl]methyl]piperazin-1-yl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1ccc(CN2CCN(c3nc(Nc4cccc(C(F)(F)F)c4)nc(OCC(F)(F)F)n3)CC2)cc1 |
| InChI | InChI=1S/C25H27F6N7O/c1-36(2)20-8-6-17(7-9-20)15-37-10-12-38(13-11-37)22-33-21(34-23(35-22)39-16-24(26,27)28)32-19-5-3-4-18(14-19)25(29,30)31/h3-9,14H,10-13,15-16H2,1-2H3,(H,32,33,34,35) |
| InChIKey | BPIUUSJWOWZJJW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|