C24H25F6N5O — CID 58039876
4-[2-[4-(diethylamino)phenyl]ethyl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 58039876) has the molecular formula C24H25F6N5O and a molecular weight of 513.49 g/mol. Its IUPAC name is 4-[2-[4-(diethylamino)phenyl]ethyl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-[4-(diethylamino)phenyl]ethyl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58039876 |
| Molecular Formula | C24H25F6N5O |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 4-[2-[4-(diethylamino)phenyl]ethyl]-6-(2,2,2-trifluoroethoxy)-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | CCN(CC)c1ccc(CCc2nc(Nc3cccc(C(F)(F)F)c3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C24H25F6N5O/c1-3-35(4-2)19-11-8-16(9-12-19)10-13-20-32-21(34-22(33-20)36-15-23(25,26)27)31-18-7-5-6-17(14-18)24(28,29)30/h5-9,11-12,14H,3-4,10,13,15H2,1-2H3,(H,31,32,33,34) |
| InChIKey | XJGNYZSZIHBAJZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|