C25H18F7N5O — CID 58040049
4-N-[[4-(3-fluorophenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 58040049) has the molecular formula C25H18F7N5O and a molecular weight of 537.44 g/mol. Its IUPAC name is 4-N-[[4-(3-fluorophenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[[4-(3-fluorophenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58040049 |
| Molecular Formula | C25H18F7N5O |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 4-N-[[4-(3-fluorophenyl)phenyl]methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Fc1cccc(-c2ccc(CNc3nc(Nc4cccc(C(F)(F)F)c4)nc(OCC(F)(F)F)n3)cc2)c1 |
| InChI | InChI=1S/C25H18F7N5O/c26-19-5-1-3-17(11-19)16-9-7-15(8-10-16)13-33-21-35-22(37-23(36-21)38-14-24(27,28)29)34-20-6-2-4-18(12-20)25(30,31)32/h1-12H,13-14H2,(H2,33,34,35,36,37) |
| InChIKey | LTGTZJPQMOZNPK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |