C20H15F6N5O3 — CID 87237386
4-N-(1,3-benzodioxol-5-ylmethyl)-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 87237386) has the molecular formula C20H15F6N5O3 and a molecular weight of 487.36 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87237386 |
| Molecular Formula | C20H15F6N5O3 |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-ylmethyl)-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)COc1nc(NCc2ccc3c(c2)OCO3)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C20H15F6N5O3/c21-19(22,23)9-32-18-30-16(27-8-11-4-5-14-15(6-11)34-10-33-14)29-17(31-18)28-13-3-1-2-12(7-13)20(24,25)26/h1-7H,8-10H2,(H2,27,28,29,30,31) |
| InChIKey | RWINRZPVKHTRRQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |