C19H14F6IN5O — CID 162601082
4-N-[(4-iodophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 162601082) has the molecular formula C19H14F6IN5O and a molecular weight of 569.25 g/mol. Its IUPAC name is 4-N-[(4-iodophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(4-iodophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 162601082 |
| Molecular Formula | C19H14F6IN5O |
| Molecular Weight | 569.25 g/mol |
| Exact Mass | 569.01 |
| IUPAC Name | 4-N-[(4-iodophenyl)methyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)COc1nc(NCc2ccc(I)cc2)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C19H14F6IN5O/c20-18(21,22)10-32-17-30-15(27-9-11-4-6-13(26)7-5-11)29-16(31-17)28-14-3-1-2-12(8-14)19(23,24)25/h1-8H,9-10H2,(H2,27,28,29,30,31) |
| InChIKey | BJYJTCAWPSUGNN-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.25 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|