C22H18F6N6O — CID 58039465
4-N-[2-(3H-indol-2-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 58039465) has the molecular formula C22H18F6N6O and a molecular weight of 496.42 g/mol. Its IUPAC name is 4-N-[2-(3H-indol-2-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-(3H-indol-2-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58039465 |
| Molecular Formula | C22H18F6N6O |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 4-N-[2-(3H-indol-2-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FC(F)(F)COc1nc(NCCC2=Nc3ccccc3C2)nc(Nc2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C22H18F6N6O/c23-21(24,25)12-35-20-33-18(29-9-8-16-10-13-4-1-2-7-17(13)30-16)32-19(34-20)31-15-6-3-5-14(11-15)22(26,27)28/h1-7,11H,8-10,12H2,(H2,29,31,32,33,34) |
| InChIKey | UBVWEYBJPMNRMR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |