C23H20F6N6O2 — CID 87237325
4-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 87237325) has the molecular formula C23H20F6N6O2 and a molecular weight of 526.44 g/mol. Its IUPAC name is 4-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 87237325 |
| Molecular Formula | C23H20F6N6O2 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 4-N-[2-(6-methoxy-1H-indol-3-yl)ethyl]-6-(2,2,2-trifluoroethoxy)-2-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc2c(CCNc3nc(Nc4cccc(C(F)(F)F)c4)nc(OCC(F)(F)F)n3)c[nH]c2c1 |
| InChI | InChI=1S/C23H20F6N6O2/c1-36-16-5-6-17-13(11-31-18(17)10-16)7-8-30-19-33-20(35-21(34-19)37-12-22(24,25)26)32-15-4-2-3-14(9-15)23(27,28)29/h2-6,9-11,31H,7-8,12H2,1H3,(H2,30,32,33,34,35) |
| InChIKey | XGJFZRIGUQGPNA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 96.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |