C14H12F6N4O3 — CID 126478513
N-(4-methoxyphenyl)-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 126478513) has the molecular formula C14H12F6N4O3 and a molecular weight of 398.26 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N-(4-methoxyphenyl)-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 126478513 |
| Molecular Formula | C14H12F6N4O3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(4-methoxyphenyl)-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Nc2nc(OCC(F)(F)F)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H12F6N4O3/c1-25-9-4-2-8(3-5-9)21-10-22-11(26-6-13(15,16)17)24-12(23-10)27-7-14(18,19)20/h2-5H,6-7H2,1H3,(H,21,22,23,24) |
| InChIKey | KOXKXHMJZBCMKQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |