C20H14F12N8O4 — CID 2826886
1-N,2-N-bis[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]benzene-1,2-diamine (PubChem CID 2826886) has the molecular formula C20H14F12N8O4 and a molecular weight of 658.36 g/mol. Its IUPAC name is 1-N,2-N-bis[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]benzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 2826886 |
| Molecular Formula | C20H14F12N8O4 |
| Molecular Weight | 658.36 g/mol |
| Exact Mass | 658.09 |
| IUPAC Name | 1-N,2-N-bis[4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]benzene-1,2-diamine |
| SMILES | FC(F)(F)COc1nc(Nc2ccccc2Nc2nc(OCC(F)(F)F)nc(OCC(F)(F)F)n2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C20H14F12N8O4/c21-17(22,23)5-41-13-35-11(36-14(39-13)42-6-18(24,25)26)33-9-3-1-2-4-10(9)34-12-37-15(43-7-19(27,28)29)40-16(38-12)44-8-20(30,31)32/h1-4H,5-8H2,(H,33,35,36,39)(H,34,37,38,40) |
| InChIKey | RRLXUJVKXBDSIF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |