C11H14F6N4O2 — CID 627767
N-butyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 627767) has the molecular formula C11H14F6N4O2 and a molecular weight of 348.25 g/mol. Its IUPAC name is N-butyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 627767 |
| Molecular Formula | C11H14F6N4O2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-butyl-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1nc(OCC(F)(F)F)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H14F6N4O2/c1-2-3-4-18-7-19-8(22-5-10(12,13)14)21-9(20-7)23-6-11(15,16)17/h2-6H2,1H3,(H,18,19,20,21) |
| InChIKey | JODYVGMEGWNLQW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|