C12H12F6N6O2 — CID 565037
N-[2-(1H-imidazol-2-yl)ethyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 565037) has the molecular formula C12H12F6N6O2 and a molecular weight of 386.26 g/mol. Its IUPAC name is N-[2-(1H-imidazol-2-yl)ethyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | N-[2-(1H-imidazol-2-yl)ethyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 565037 |
| Molecular Formula | C12H12F6N6O2 |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-(1H-imidazol-2-yl)ethyl]-4,6-bis(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)COc1nc(NCCc2ncc[nH]2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H12F6N6O2/c13-11(14,15)5-25-9-22-8(21-2-1-7-19-3-4-20-7)23-10(24-9)26-6-12(16,17)18/h3-4H,1-2,5-6H2,(H,19,20)(H,21,22,23,24) |
| InChIKey | OZEHMXCLFOHWSH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |