C12H20F3N5O — CID 82782437
2-N,2-N-dimethyl-4-N-propyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 82782437) has the molecular formula C12H20F3N5O and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-propyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-propyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 82782437 |
| Molecular Formula | C12H20F3N5O |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-propyl-6-(4,4,4-trifluorobutoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCNc1nc(OCCCC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H20F3N5O/c1-4-7-16-9-17-10(20(2)3)19-11(18-9)21-8-5-6-12(13,14)15/h4-8H2,1-3H3,(H,16,17,18,19) |
| InChIKey | QFRFPXBYLFYKOB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|