C10H17F3N6O — CID 115523299
4-hydrazinyl-6-propoxy-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine (PubChem CID 115523299) has the molecular formula C10H17F3N6O and a molecular weight of 294.28 g/mol. Its IUPAC name is 4-hydrazinyl-6-propoxy-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-6-propoxy-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115523299 |
| Molecular Formula | C10H17F3N6O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-hydrazinyl-6-propoxy-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NN)nc(NCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H17F3N6O/c1-2-6-20-9-17-7(16-8(18-9)19-14)15-5-3-4-10(11,12)13/h2-6,14H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | LPUQNCHYTCFBDO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|