C17H23F3N6O3 — CID 163151797
4-[[4-(hexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-hydroxybenzeneamine oxide (PubChem CID 163151797) has the molecular formula C17H23F3N6O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is 4-[[4-(hexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[[4-(hexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163151797 |
| Molecular Formula | C17H23F3N6O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-[[4-(hexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]-N-hydroxybenzeneamine oxide |
| SMILES | CCCCCCNc1nc(Nc2ccc([NH+]([O-])O)cc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C17H23F3N6O3/c1-2-3-4-5-10-21-14-23-15(25-16(24-14)29-11-17(18,19)20)22-12-6-8-13(9-7-12)26(27)28/h6-9,26-27H,2-5,10-11H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | NPMUBRXTYJTEPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|