C16H17F6N5O2 — CID 5171027
2-N-butan-2-yl-6-(2,2,2-trifluoroethoxy)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 5171027) has the molecular formula C16H17F6N5O2 and a molecular weight of 425.33 g/mol. Its IUPAC name is 2-N-butan-2-yl-6-(2,2,2-trifluoroethoxy)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butan-2-yl-6-(2,2,2-trifluoroethoxy)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5171027 |
| Molecular Formula | C16H17F6N5O2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-N-butan-2-yl-6-(2,2,2-trifluoroethoxy)-4-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(C)Nc1nc(Nc2ccc(OC(F)(F)F)cc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C16H17F6N5O2/c1-3-9(2)23-12-25-13(27-14(26-12)28-8-15(17,18)19)24-10-4-6-11(7-5-10)29-16(20,21)22/h4-7,9H,3,8H2,1-2H3,(H2,23,24,25,26,27) |
| InChIKey | LJXXHABBIKZHFO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |