C30H37F3N6O6 — CID 67074240
4-[[4-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 67074240) has the molecular formula C30H37F3N6O6 and a molecular weight of 634.66 g/mol. Its IUPAC name is 4-[[4-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 67074240 |
| Molecular Formula | C30H37F3N6O6 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 4-[[4-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCCOc1ccc(CNc2nc(Nc3ccc(C(=O)O)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C30H37F3N6O6/c1-29(2,3)45-28(42)34-16-6-4-5-7-17-43-23-14-8-20(9-15-23)18-35-25-37-26(39-27(38-25)44-19-30(31,32)33)36-22-12-10-21(11-13-22)24(40)41/h8-15H,4-7,16-19H2,1-3H3,(H,34,42)(H,40,41)(H2,35,36,37,38,39) |
| InChIKey | JFNXTDRBODQJHJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|