C31H40F3N7O6 — CID 162544689
4-(aminomethyl)-N-[3-[2-[2-[3-[[4-[[4-methyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propoxy]ethoxy]ethoxy]propyl]benzamide (PubChem CID 162544689) has the molecular formula C31H40F3N7O6 and a molecular weight of 663.70 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[2-[2-[3-[[4-[[4-methyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propoxy]ethoxy]ethoxy]propyl]benzamide.
| Compound Name | 4-(aminomethyl)-N-[3-[2-[2-[3-[[4-[[4-methyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propoxy]ethoxy]ethoxy]propyl]benzamide |
|---|---|
| PubChem CID | 162544689 |
| Molecular Formula | C31H40F3N7O6 |
| Molecular Weight | 663.70 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[2-[2-[3-[[4-[[4-methyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]propoxy]ethoxy]ethoxy]propyl]benzamide |
| SMILES | Cc1nc(Nc2ccc(C(=O)NCCCOCCOCCOCCCNC(=O)c3ccc(CN)cc3)cc2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C31H40F3N7O6/c1-22-38-29(41-30(39-22)47-21-31(32,33)34)40-26-10-8-25(9-11-26)28(43)37-13-3-15-45-17-19-46-18-16-44-14-2-12-36-27(42)24-6-4-23(20-35)5-7-24/h4-11H,2-3,12-21,35H2,1H3,(H,36,42)(H,37,43)(H,38,39,40,41) |
| InChIKey | SPNANQODBHSTFD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|