C33H41ClF3N7O5 — CID 118388962
tert-butyl-[3-[[4-[[4-[[4-[2-(chloromethyl)prop-2-enoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid (PubChem CID 118388962) has the molecular formula C33H41ClF3N7O5 and a molecular weight of 708.18 g/mol. Its IUPAC name is tert-butyl-[3-[[4-[[4-[[4-[2-(chloromethyl)prop-2-enoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | tert-butyl-[3-[[4-[[4-[[4-[2-(chloromethyl)prop-2-enoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 118388962 |
| Molecular Formula | C33H41ClF3N7O5 |
| Molecular Weight | 708.18 g/mol |
| Exact Mass | 707.28 |
| IUPAC Name | tert-butyl-[3-[[4-[[4-[[4-[2-(chloromethyl)prop-2-enoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid |
| SMILES | C=C(CCl)COc1ccc(CNc2nc(Nc3ccc(C(=O)NCC(C)(C)CN(C(=O)O)C(C)(C)C)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C33H41ClF3N7O5/c1-21(15-34)17-48-25-13-7-22(8-14-25)16-38-27-41-28(43-29(42-27)49-20-33(35,36)37)40-24-11-9-23(10-12-24)26(45)39-18-32(5,6)19-44(30(46)47)31(2,3)4/h7-14H,1,15-20H2,2-6H3,(H,39,45)(H,46,47)(H2,38,40,41,42,43) |
| InChIKey | GSQPELNVJCQPPK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.18 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|