C26H30F3N7O5 — CID 90333766
methyl 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetate (PubChem CID 90333766) has the molecular formula C26H30F3N7O5 and a molecular weight of 577.56 g/mol. Its IUPAC name is methyl 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 90333766 |
| Molecular Formula | C26H30F3N7O5 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | methyl 2-[[3-[4-[[4-[(4-hydroxyphenyl)methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NCC(C)(C)CNc1ccc(Nc2nc(NCc3ccc(O)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C26H30F3N7O5/c1-25(2,14-32-20(38)21(39)40-3)13-31-17-6-8-18(9-7-17)33-23-34-22(30-12-16-4-10-19(37)11-5-16)35-24(36-23)41-15-26(27,28)29/h4-11,31,37H,12-15H2,1-3H3,(H,32,38)(H2,30,33,34,35,36) |
| InChIKey | FMVBRPFHXAJDGB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|