C29H34BrF3N6O5 — CID 89498021
[3-[[4-[[2-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid (PubChem CID 89498021) has the molecular formula C29H34BrF3N6O5 and a molecular weight of 683.53 g/mol. Its IUPAC name is [3-[[4-[[2-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [3-[[4-[[2-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 89498021 |
| Molecular Formula | C29H34BrF3N6O5 |
| Molecular Weight | 683.53 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | [3-[[4-[[2-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]amino]benzoyl]amino]-2,2-dimethylpropyl]carbamic acid |
| SMILES | CC(C)(CNC(=O)O)CNC(=O)c1ccc(Nc2cc(OCC(F)(F)F)nc(NCc3ccc(OCCCBr)cc3)n2)cc1 |
| InChI | InChI=1S/C29H34BrF3N6O5/c1-28(2,17-36-27(41)42)16-35-25(40)20-6-8-21(9-7-20)37-23-14-24(44-18-29(31,32)33)39-26(38-23)34-15-19-4-10-22(11-5-19)43-13-3-12-30/h4-11,14,36H,3,12-13,15-18H2,1-2H3,(H,35,40)(H,41,42)(H2,34,37,38,39) |
| InChIKey | XZDBZSIQEFKTDD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 146.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|