C27H30BrF3N4O4 — CID 86680948
tert-butyl 4-[[4-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]benzoate (PubChem CID 86680948) has the molecular formula C27H30BrF3N4O4 and a molecular weight of 611.46 g/mol. Its IUPAC name is tert-butyl 4-[[4-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 86680948 |
| Molecular Formula | C27H30BrF3N4O4 |
| Molecular Weight | 611.46 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | tert-butyl 4-[[4-[[4-(3-bromopropoxy)phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)pyrimidin-2-yl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Nc2nc(NCc3ccc(OCCCBr)cc3)cc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H30BrF3N4O4/c1-26(2,3)39-24(36)19-7-9-20(10-8-19)33-25-34-22(15-23(35-25)38-17-27(29,30)31)32-16-18-5-11-21(12-6-18)37-14-4-13-28/h5-12,15H,4,13-14,16-17H2,1-3H3,(H2,32,33,34,35) |
| InChIKey | FGPNKPAVVCMNDS-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.46 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|