C31H40F3N7O6 — CID 67074132
ethyl 4-[[4-[[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]propoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 67074132) has the molecular formula C31H40F3N7O6 and a molecular weight of 663.70 g/mol. Its IUPAC name is ethyl 4-[[4-[[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]propoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-[[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]propoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 67074132 |
| Molecular Formula | C31H40F3N7O6 |
| Molecular Weight | 663.70 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | ethyl 4-[[4-[[4-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]propoxy]phenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2nc(NCc3ccc(OCCCNCCNC(=O)OC(C)(C)C)cc3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C31H40F3N7O6/c1-5-44-25(42)22-9-11-23(12-10-22)38-27-39-26(40-28(41-27)46-20-31(32,33)34)37-19-21-7-13-24(14-8-21)45-18-6-15-35-16-17-36-29(43)47-30(2,3)4/h7-14,35H,5-6,15-20H2,1-4H3,(H,36,43)(H2,37,38,39,40,41) |
| InChIKey | JKKCPURTIRFFHP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|