C15H19ClIN5 — CID 5124094
6-chloro-4-N-hexyl-2-N-(4-iodophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 5124094) has the molecular formula C15H19ClIN5 and a molecular weight of 431.71 g/mol. Its IUPAC name is 6-chloro-4-N-hexyl-2-N-(4-iodophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-hexyl-2-N-(4-iodophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 5124094 |
| Molecular Formula | C15H19ClIN5 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 6-chloro-4-N-hexyl-2-N-(4-iodophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCNc1nc(Cl)nc(Nc2ccc(I)cc2)n1 |
| InChI | InChI=1S/C15H19ClIN5/c1-2-3-4-5-10-18-14-20-13(16)21-15(22-14)19-12-8-6-11(17)7-9-12/h6-9H,2-5,10H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | CTENRBSVYXTZAK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|