C16H26Cl2N10 — CID 134109285
4-chloro-6-[2-[4-chloro-6-(pentylamino)-1,3,5-triazin-2-yl]hydrazinyl]-N-pentyl-1,3,5-triazin-2-amine (PubChem CID 134109285) has the molecular formula C16H26Cl2N10 and a molecular weight of 429.36 g/mol. Its IUPAC name is 4-chloro-6-[2-[4-chloro-6-(pentylamino)-1,3,5-triazin-2-yl]hydrazinyl]-N-pentyl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-[2-[4-chloro-6-(pentylamino)-1,3,5-triazin-2-yl]hydrazinyl]-N-pentyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134109285 |
| Molecular Formula | C16H26Cl2N10 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 4-chloro-6-[2-[4-chloro-6-(pentylamino)-1,3,5-triazin-2-yl]hydrazinyl]-N-pentyl-1,3,5-triazin-2-amine |
| SMILES | CCCCCNc1nc(Cl)nc(NNc2nc(Cl)nc(NCCCCC)n2)n1 |
| InChI | InChI=1S/C16H26Cl2N10/c1-3-5-7-9-19-13-21-11(17)23-15(25-13)27-28-16-24-12(18)22-14(26-16)20-10-8-6-4-2/h3-10H2,1-2H3,(H2,19,21,23,25,27)(H2,20,22,24,26,28) |
| InChIKey | CZTKSTJRVMBQLT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|