C11H12ClN5 — CID 6452884
6-chloro-4-N-ethyl-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 6452884) has the molecular formula C11H12ClN5 and a molecular weight of 249.71 g/mol. Its IUPAC name is 6-chloro-4-N-ethyl-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-ethyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 6452884 |
| Molecular Formula | C11H12ClN5 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 6-chloro-4-N-ethyl-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C11H12ClN5/c1-2-13-10-15-9(12)16-11(17-10)14-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | WKGKIZFYYWEEHC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |