C12H15N5O — CID 80768361
4-N-ethyl-6-methoxy-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 80768361) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-N-ethyl-6-methoxy-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-6-methoxy-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80768361 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 4-N-ethyl-6-methoxy-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Nc2ccccc2)nc(OC)n1 |
| InChI | InChI=1S/C12H15N5O/c1-3-13-10-15-11(17-12(16-10)18-2)14-9-7-5-4-6-8-9/h4-8H,3H2,1-2H3,(H2,13,14,15,16,17) |
| InChIKey | LRBOCQDOGCEEGK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |