C9H17N5O — CID 80785433
2-N-butyl-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine (PubChem CID 80785433) has the molecular formula C9H17N5O and a molecular weight of 211.27 g/mol. Its IUPAC name is 2-N-butyl-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butyl-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80785433 |
| Molecular Formula | C9H17N5O |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-N-butyl-6-methoxy-4-N-methyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(NC)nc(OC)n1 |
| InChI | InChI=1S/C9H17N5O/c1-4-5-6-11-8-12-7(10-2)13-9(14-8)15-3/h4-6H2,1-3H3,(H2,10,11,12,13,14) |
| InChIKey | VOHHLUSGLNHGIB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|