C10H19N5O3 — CID 106311525
2-[3-[[4-methoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol (PubChem CID 106311525) has the molecular formula C10H19N5O3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-[3-[[4-methoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol.
| Compound Name | 2-[3-[[4-methoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311525 |
| Molecular Formula | C10H19N5O3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-[3-[[4-methoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol |
| SMILES | CNc1nc(NCCCOCCO)nc(OC)n1 |
| InChI | InChI=1S/C10H19N5O3/c1-11-8-13-9(15-10(14-8)17-2)12-4-3-6-18-7-5-16/h16H,3-7H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | QKXJJSHLVORZLV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|