C11H20ClN5O2 — CID 106311585
2-[3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol (PubChem CID 106311585) has the molecular formula C11H20ClN5O2 and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-[3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol.
| Compound Name | 2-[3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311585 |
| Molecular Formula | C11H20ClN5O2 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[3-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]propoxy]ethanol |
| SMILES | CCCNc1nc(Cl)nc(NCCCOCCO)n1 |
| InChI | InChI=1S/C11H20ClN5O2/c1-2-4-13-10-15-9(12)16-11(17-10)14-5-3-7-19-8-6-18/h18H,2-8H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | FYLMPFWFMHJJGW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|