C11H15ClN6O2 — CID 106311250
2-[3-[(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]propoxy]ethanol (PubChem CID 106311250) has the molecular formula C11H15ClN6O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-[3-[(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]propoxy]ethanol.
| Compound Name | 2-[3-[(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]propoxy]ethanol |
|---|---|
| PubChem CID | 106311250 |
| Molecular Formula | C11H15ClN6O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[3-[(4-chloro-6-pyrazol-1-yl-1,3,5-triazin-2-yl)amino]propoxy]ethanol |
| SMILES | OCCOCCCNc1nc(Cl)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H15ClN6O2/c12-9-15-10(13-3-2-7-20-8-6-19)17-11(16-9)18-5-1-4-14-18/h1,4-5,19H,2-3,6-8H2,(H,13,15,16,17) |
| InChIKey | IEJNEAUBEQWHBR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|