C12H17ClN6 — CID 63003609
4-chloro-N-(4-methylpentyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine (PubChem CID 63003609) has the molecular formula C12H17ClN6 and a molecular weight of 280.76 g/mol. Its IUPAC name is 4-chloro-N-(4-methylpentyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(4-methylpentyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 63003609 |
| Molecular Formula | C12H17ClN6 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-chloro-N-(4-methylpentyl)-6-pyrazol-1-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)CCCNc1nc(Cl)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H17ClN6/c1-9(2)5-3-6-14-11-16-10(13)17-12(18-11)19-8-4-7-15-19/h4,7-9H,3,5-6H2,1-2H3,(H,14,16,17,18) |
| InChIKey | NKMGZOZUJJQUAC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|