C12H19N7 — CID 80785977
2-N-butyl-4-N-ethyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80785977) has the molecular formula C12H19N7 and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-N-butyl-4-N-ethyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-ethyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80785977 |
| Molecular Formula | C12H19N7 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-N-butyl-4-N-ethyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(NCC)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C12H19N7/c1-3-5-7-14-11-16-10(13-4-2)17-12(18-11)19-9-6-8-15-19/h6,8-9H,3-5,7H2,1-2H3,(H2,13,14,16,17,18) |
| InChIKey | RUXPIAWLGRKQQV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|