C13H22N8 — CID 80796786
2-N-[4-(dimethylamino)butyl]-4-N-methyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80796786) has the molecular formula C13H22N8 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)butyl]-4-N-methyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)butyl]-4-N-methyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80796786 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-N-[4-(dimethylamino)butyl]-4-N-methyl-6-pyrazol-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(NCCCCN(C)C)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C13H22N8/c1-14-11-17-12(15-7-4-5-9-20(2)3)19-13(18-11)21-10-6-8-16-21/h6,8,10H,4-5,7,9H2,1-3H3,(H2,14,15,17,18,19) |
| InChIKey | JWGDIPDPUBRTJE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|